Products 1323077-88-8
CAS 1323077-88-8 appears in our catalog under these names: (S)–Enzaplatovir, (S)-Enzaplatovir, 99%, 99%, (S)-Enzaplatovir, 99.73%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 5 mg, 50 mg, 10mM/1mL, 25 mg, 10 mg.
(3S)-4-(3-methyl-1,2-oxazole-4-carbonyl)-3-(6-methyl-3-pyridinyl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one (CAS 1323077-88-8) is a chemical compound with the molecular formula C20H19N5O3 and a molecular weight of 377.4 g/mol. IUPAC name: (3S)-4-(3-methyl-1,2-oxazole-4-carbonyl)-3-(6-methyl-3-pyridinyl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one. InChIKey: KUDXTBCRESIJFH-HXUWFJFHSA-N.
| Molecular formula | C20H19N5O3 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | (3S)-4-(3-methyl-1,2-oxazole-4-carbonyl)-3-(6-methyl-3-pyridinyl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one |
| InChIKey | KUDXTBCRESIJFH-HXUWFJFHSA-N |
| SMILES | CC1=NC=C(C=C1)[C@@]23CN4C=CC=C4C(=O)N2CCN3C(=O)C5=CON=C5C |
Computed by PubChem (NCBI)
Synonyms:
(S)-Enzaplatovir, orb1692499