Products 863599-15-9

CAS 863599-15-9 is the registry number for FAK-IN-19, 99.79%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 50 mg, 5 mg, 10mM/1mL, 10 mg.

Structural formula: {0} (CAS {1})

7-pyridin-2-yl-N-(3,4,5-trimethoxyphenyl)pyrrolo[2,3-d]pyrimidin-2-amine (CAS 863599-15-9) is a chemical compound with the molecular formula C20H19N5O3 and a molecular weight of 377.4 g/mol. IUPAC name: 7-pyridin-2-yl-N-(3,4,5-trimethoxyphenyl)pyrrolo[2,3-d]pyrimidin-2-amine. InChIKey: YENZSPIOXMNEFF-UHFFFAOYSA-N.

Identity
Molecular formulaC20H19N5O3
Molecular weight377.4 g/mol
IUPAC name7-pyridin-2-yl-N-(3,4,5-trimethoxyphenyl)pyrrolo[2,3-d]pyrimidin-2-amine
InChIKeyYENZSPIOXMNEFF-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)OC)NC2=NC=C3C=CN(C3=N2)C4=CC=CC=N4

Computed by PubChem (NCBI)