Products 1323077-89-9
CAS 1323077-89-9 appears in our catalog under these names: Enzaplatovir/ 99.72% (existing batch purity), Enzaplatovir, Enzaplatovir, 99.98%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 25 mg.
(3R)-4-(3-methyl-1,2-oxazole-4-carbonyl)-3-(6-methyl-3-pyridinyl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one (CAS 1323077-89-9) is a chemical compound with the molecular formula C20H19N5O3 and a molecular weight of 377.4 g/mol. IUPAC name: (3R)-4-(3-methyl-1,2-oxazole-4-carbonyl)-3-(6-methyl-3-pyridinyl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one. InChIKey: KUDXTBCRESIJFH-FQEVSTJZSA-N.
| Molecular formula | C20H19N5O3 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | (3R)-4-(3-methyl-1,2-oxazole-4-carbonyl)-3-(6-methyl-3-pyridinyl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one |
| InChIKey | KUDXTBCRESIJFH-FQEVSTJZSA-N |
| SMILES | CC1=NC=C(C=C1)[C@]23CN4C=CC=C4C(=O)N2CCN3C(=O)C5=CON=C5C |
Computed by PubChem (NCBI)