CAS 132335-47-8 appears in our catalog under these names: Duloxetine Impurity 8 Oxalate, S-(+)-N,N-Dimethyl-3-(1-naphthoxy)-3-(2-thienyl)-1-propylamine oxalate, 95%, N-Methyl Duloxetine Oxalate, >95% (HPLC), (3S)-N,N-Dimethyl-3-(naphthalen-1-yloxy)-3-(thiophen-2-yl)propan-1-amine Oxalate (N-Methylduloxetine Oxalate), (S)–N,N–Dimethyl–3–(naphthalen–1–yloxy)–3–(thiophen–2–yl)propan–1–amine oxalate. Offered by: Chemat Brand, Combi-blocks, TRC, Mikromol, GLPBio. Available pack sizes: on request, 5g, 25g, 1g, 10g, 25mg, 50g, 5 g.
(3S)-N,N-dimethyl-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine;oxalic acid (CAS 132335-47-8) is a chemical compound with the molecular formula C21H23NO5S and a molecular weight of 401.5 g/mol. IUPAC name: (3S)-N,N-dimethyl-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine;oxalic acid. InChIKey: GYUDMXKAVMKVPS-FERBBOLQSA-N.
| Molecular formula | C21H23NO5S |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | (3S)-N,N-dimethyl-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine;oxalic acid |
| InChIKey | GYUDMXKAVMKVPS-FERBBOLQSA-N |
| SMILES | CN(C)CC[C@@H](C1=CC=CS1)OC2=CC=CC3=CC=CC=C32.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)