Products 932013-45-1

CAS 932013-45-1 is the registry number for Duloxetine Impurity 13 Oxalate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3R)-N,N-dimethyl-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine;oxalic acid (CAS 932013-45-1) is a chemical compound with the molecular formula C21H23NO5S and a molecular weight of 401.5 g/mol. IUPAC name: (3R)-N,N-dimethyl-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine;oxalic acid. InChIKey: GYUDMXKAVMKVPS-GMUIIQOCSA-N.

Identity
Molecular formulaC21H23NO5S
Molecular weight401.5 g/mol
IUPAC name(3R)-N,N-dimethyl-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine;oxalic acid
InChIKeyGYUDMXKAVMKVPS-GMUIIQOCSA-N
SMILESCN(C)CC[C@H](C1=CC=CS1)OC2=CC=CC3=CC=CC=C32.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)