CAS 932013-45-1 is the registry number for Duloxetine Impurity 13 Oxalate. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-N,N-dimethyl-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine;oxalic acid (CAS 932013-45-1) is a chemical compound with the molecular formula C21H23NO5S and a molecular weight of 401.5 g/mol. IUPAC name: (3R)-N,N-dimethyl-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine;oxalic acid. InChIKey: GYUDMXKAVMKVPS-GMUIIQOCSA-N.
| Molecular formula | C21H23NO5S |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | (3R)-N,N-dimethyl-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine;oxalic acid |
| InChIKey | GYUDMXKAVMKVPS-GMUIIQOCSA-N |
| SMILES | CN(C)CC[C@H](C1=CC=CS1)OC2=CC=CC3=CC=CC=C32.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)