Products 1384513-86-3
CAS 1384513-86-3 is the registry number for N-(2-Butyl-3-(4-methoxybenzoyl)-5-benzofuranyl)-methanesulfonamide. Offered by: TRC. Available pack sizes: 2,5g.
N-[2-butyl-3-(4-methoxybenzoyl)-1-benzofuran-5-yl]methanesulfonamide (CAS 1384513-86-3) is a chemical compound with the molecular formula C21H23NO5S and a molecular weight of 401.5 g/mol. IUPAC name: N-[2-butyl-3-(4-methoxybenzoyl)-1-benzofuran-5-yl]methanesulfonamide. InChIKey: TUWODEPFKKGUES-UHFFFAOYSA-N.
| Molecular formula | C21H23NO5S |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | N-[2-butyl-3-(4-methoxybenzoyl)-1-benzofuran-5-yl]methanesulfonamide |
| InChIKey | TUWODEPFKKGUES-UHFFFAOYSA-N |
| SMILES | CCCCC1=C(C2=C(O1)C=CC(=C2)NS(=O)(=O)C)C(=O)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)