Products 132342-55-3
CAS 132342-55-3 is the registry number for Methyl isocostate. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
Methyl 2-[(2R,4aR)-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]prop-2-enoate (CAS 132342-55-3) is a chemical compound with the molecular formula C16H24O2 and a molecular weight of 248.36 g/mol. IUPAC name: methyl 2-[(2R,4aR)-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]prop-2-enoate. InChIKey: OWZSHJKGKHTKDS-CZUORRHYSA-N.
| Molecular formula | C16H24O2 |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | methyl 2-[(2R,4aR)-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]prop-2-enoate |
| InChIKey | OWZSHJKGKHTKDS-CZUORRHYSA-N |
| SMILES | CC1=C2C[C@@H](CC[C@]2(CCC1)C)C(=C)C(=O)OC |
Computed by PubChem (NCBI)