Products 1323966-13-7

CAS 1323966-13-7 is the registry number for 3-(4-Chloro-2-fluoro-3-methoxyphenyl)propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(4-chloro-2-fluoro-3-methoxyphenyl)propanoic acid (CAS 1323966-13-7) is a chemical compound with the molecular formula C10H10ClFO3 and a molecular weight of 232.63 g/mol. IUPAC name: 3-(4-chloro-2-fluoro-3-methoxyphenyl)propanoic acid. InChIKey: MJIGCENLUSLAFF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10ClFO3
Molecular weight232.63 g/mol
IUPAC name3-(4-chloro-2-fluoro-3-methoxyphenyl)propanoic acid
InChIKeyMJIGCENLUSLAFF-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1F)CCC(=O)O)Cl

Computed by PubChem (NCBI)