Products 1782642-42-5
CAS 1782642-42-5 appears in our catalog under these names: 3-Chloro-5-fluoro-2-(propan-2-yloxy)benzoic acid, 95%, 3-Chloro-5-fluoro-2-isopropoxybenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
3-chloro-5-fluoro-2-propan-2-yloxybenzoic acid (CAS 1782642-42-5) is a chemical compound with the molecular formula C10H10ClFO3 and a molecular weight of 232.63 g/mol. IUPAC name: 3-chloro-5-fluoro-2-propan-2-yloxybenzoic acid. InChIKey: QFNNEXLMECMTDH-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFO3 |
|---|---|
| Molecular weight | 232.63 g/mol |
| IUPAC name | 3-chloro-5-fluoro-2-propan-2-yloxybenzoic acid |
| InChIKey | QFNNEXLMECMTDH-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1Cl)F)C(=O)O |
Computed by PubChem (NCBI)