CAS 2112478-44-9 is the registry number for Ethyl 3-chloro-2-fluoro-4-methoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
Ethyl 3-chloro-2-fluoro-4-methoxybenzoate (CAS 2112478-44-9) is a chemical compound with the molecular formula C10H10ClFO3 and a molecular weight of 232.63 g/mol. IUPAC name: ethyl 3-chloro-2-fluoro-4-methoxybenzoate. InChIKey: MYZKBJCPXUEGBC-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFO3 |
|---|---|
| Molecular weight | 232.63 g/mol |
| IUPAC name | ethyl 3-chloro-2-fluoro-4-methoxybenzoate |
| InChIKey | MYZKBJCPXUEGBC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(C=C1)OC)Cl)F |
Computed by PubChem (NCBI)