CAS 132526-08-0 is the registry number for Ethyl benzo(b)thiophene–6–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
Ethyl 1-benzothiophene-6-carboxylate (CAS 132526-08-0) is a chemical compound with the molecular formula C11H10O2S and a molecular weight of 206.26 g/mol. IUPAC name: ethyl 1-benzothiophene-6-carboxylate. InChIKey: QBZJNXZGYVMAML-UHFFFAOYSA-N.
| Molecular formula | C11H10O2S |
|---|---|
| Molecular weight | 206.26 g/mol |
| IUPAC name | ethyl 1-benzothiophene-6-carboxylate |
| InChIKey | QBZJNXZGYVMAML-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)C=CS2 |
Computed by PubChem (NCBI)