Products 1325304-60-6
CAS 1325304-60-6 is the registry number for 5-Oxo-1,2,3,5-tetrahydroimidazo[1,2-a]pyridine-8-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyridine-8-carboxylic acid (CAS 1325304-60-6) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: 5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyridine-8-carboxylic acid. InChIKey: GCVCGPPYESIYPU-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyridine-8-carboxylic acid |
| InChIKey | GCVCGPPYESIYPU-UHFFFAOYSA-N |
| SMILES | C1CN2C(=O)C=CC(=C2N1)C(=O)O |
Computed by PubChem (NCBI)