CAS 13254-07-4 is the registry number for Z-Ile-phe-oh, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
(2S)-2-[[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-phenylpropanoic acid (CAS 13254-07-4) is a chemical compound with the molecular formula C23H28N2O5 and a molecular weight of 412.5 g/mol. IUPAC name: (2S)-2-[[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-phenylpropanoic acid. InChIKey: ARWIWKBRNYMFJM-VDGAXYAQSA-N.
| Molecular formula | C23H28N2O5 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | (2S)-2-[[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-phenylpropanoic acid |
| InChIKey | ARWIWKBRNYMFJM-VDGAXYAQSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)