CAS 4313-73-9 appears in our catalog under these names: Z–Phe–Leu–OH, Z-Phe-Leu-OH, Cbz-Phe-Leu-OH 95%, N-CBZ-PHE-LEU, Z-Phe-Leu-OH, 97%, 97%. Offered by: GLPBio, Biosynth, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 10g, 25g, 5g, 250mg, 1g, 25 g, 5 g, 10 g.
4-methyl-2-[[3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoic acid (CAS 4313-73-9) is a chemical compound with the molecular formula C23H28N2O5 and a molecular weight of 412.5 g/mol. IUPAC name: 4-methyl-2-[[3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoic acid. InChIKey: IBOXOGVHBFUSFH-UHFFFAOYSA-N.
| Molecular formula | C23H28N2O5 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | 4-methyl-2-[[3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoic acid |
| InChIKey | IBOXOGVHBFUSFH-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)O)NC(=O)C(CC1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)