CAS 6401-63-4 appears in our catalog under these names: Z-Leu-phe-oh, 98%, Z–Leu–Phe–OH. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg, 25g.
(2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-phenylpropanoic acid (CAS 6401-63-4) is a chemical compound with the molecular formula C23H28N2O5 and a molecular weight of 412.5 g/mol. IUPAC name: (2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-phenylpropanoic acid. InChIKey: FGUNAJHARUGMEF-PMACEKPBSA-N.
| Molecular formula | C23H28N2O5 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | (2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-phenylpropanoic acid |
| InChIKey | FGUNAJHARUGMEF-PMACEKPBSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)