CAS 1325559-13-4 appears in our catalog under these names: Phenylbutazone-13C12, >95% (HPLC), Phenylbutazone–13C12, PHENYLBUTAZONE-(DIPHENYL-13C12), Phenylbutazone-13C12, 99.90%, 13C12-Phenylbutazone, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, GLPBio, Sigma-Aldrich, MedChemExpress, HPC Standards. Available pack sizes: 10mg, 1mg, 5mg, 5 mg, 1 mg, 1x1ml, 1x10mg.
4-butyl-1,2-di((1,2,3,4,5,6-13C6)cyclohexatrienyl)pyrazolidine-3,5-dione (CAS 1325559-13-4) is a chemical compound with the molecular formula C19H20N2O2 and a molecular weight of 320.29 g/mol. IUPAC name: 4-butyl-1,2-di((1,2,3,4,5,6-13C6)cyclohexatrienyl)pyrazolidine-3,5-dione. InChIKey: VYMDGNCVAMGZFE-ZDLJAUBWSA-N.
| Molecular formula | C19H20N2O2 |
|---|---|
| Molecular weight | 320.29 g/mol |
| IUPAC name | 4-butyl-1,2-di((1,2,3,4,5,6-13C6)cyclohexatrienyl)pyrazolidine-3,5-dione |
| InChIKey | VYMDGNCVAMGZFE-ZDLJAUBWSA-N |
| SMILES | CCCCC1C(=O)N(N(C1=O)[13C]2=[13CH][13CH]=[13CH][13CH]=[13CH]2)[13C]3=[13CH][13CH]=[13CH][13CH]=[13CH]3 |
Computed by PubChem (NCBI)