Products 132557-73-4
CAS 132557-73-4 is the registry number for 2，3，3–Trimethyl–3H–Indole–5–Sulfonic Acid. Offered by: GLPBio. Available pack sizes: 1g.
2,3,3-trimethylindole-5-sulfonic acid (CAS 132557-73-4) is a chemical compound with the molecular formula C11H13NO3S and a molecular weight of 239.29 g/mol. IUPAC name: 2,3,3-trimethylindole-5-sulfonic acid. InChIKey: HUFDYAIAEFHOKI-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3S |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | 2,3,3-trimethylindole-5-sulfonic acid |
| InChIKey | HUFDYAIAEFHOKI-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C1(C)C)C=C(C=C2)S(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2,3,3-trimethyl-3H-indole-5-sulfonic acid, 2,3,3-trimethylindole-5-sulfonic Acid, 3H-Indole-5-sulfonic acid, 2,3,3-trimethyl-, 5-Sulfo-2,3,3-trimethyl indolenine sodium salt, 5-sulfo-2,3,3-trimethylindolenine, 3H-Indole-5-sulfonicacid, 2,3,3-trimethyl-, 5-sulpho-2,3,3-trimethylindole, HUFDYAIAEFHOKI-UHFFFAOYSA-N, 2,3,3-trimethyl-5-sulpho-indole, 2,3,3-trimethyl-5-indolesulfonic acid