CAS 1325681-80-8 is the registry number for 1-Benzoyl-N-phenyl-1H-indazole-3-carboxamide. Offered by: Biosynth. Available pack sizes: 5000mg.
1-benzoyl-N-phenylindazole-3-carboxamide (CAS 1325681-80-8) is a chemical compound with the molecular formula C21H15N3O2 and a molecular weight of 341.4 g/mol. IUPAC name: 1-benzoyl-N-phenylindazole-3-carboxamide. InChIKey: JFOMBLRSRUFMKX-UHFFFAOYSA-N.
| Molecular formula | C21H15N3O2 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 1-benzoyl-N-phenylindazole-3-carboxamide |
| InChIKey | JFOMBLRSRUFMKX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N2C3=CC=CC=C3C(=N2)C(=O)NC4=CC=CC=C4 |
Computed by PubChem (NCBI)