Products 1347815-29-5
CAS 1347815-29-5 is the registry number for (9H-Fluoren-9-yl)methyl (5-cyanopyridin-2-yl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
9H-fluoren-9-ylmethyl N-(5-cyano-2-pyridinyl)carbamate (CAS 1347815-29-5) is a chemical compound with the molecular formula C21H15N3O2 and a molecular weight of 341.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(5-cyano-2-pyridinyl)carbamate. InChIKey: JOJVPSBDBBZLFB-UHFFFAOYSA-N.
| Molecular formula | C21H15N3O2 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(5-cyano-2-pyridinyl)carbamate |
| InChIKey | JOJVPSBDBBZLFB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=NC=C(C=C4)C#N |
Computed by PubChem (NCBI)