CAS 138615-26-6 is the registry number for 4-(3-(1-Pyrenyl)propyl)-3H-1,2,4-triazole-3,5(4H)-dione. Offered by: TRC. Available pack sizes: 250mg.
4-(3-pyren-1-ylpropyl)-1,2,4-triazole-3,5-dione (CAS 138615-26-6) is a chemical compound with the molecular formula C21H15N3O2 and a molecular weight of 341.4 g/mol. IUPAC name: 4-(3-pyren-1-ylpropyl)-1,2,4-triazole-3,5-dione. InChIKey: DMXQNKNVUICAKV-UHFFFAOYSA-N.
| Molecular formula | C21H15N3O2 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 4-(3-pyren-1-ylpropyl)-1,2,4-triazole-3,5-dione |
| InChIKey | DMXQNKNVUICAKV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)CCCN5C(=O)N=NC5=O |
Computed by PubChem (NCBI)