CAS 132573-12-7 appears in our catalog under these names: 1-(3-Chlorophenyl)piperidin-2-one, 98%, 1-(3-Chlorophenyl)piperidin-2-one 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 1g, 5g, 250mg.
1-(3-chlorophenyl)piperidin-2-one (CAS 132573-12-7) is a chemical compound with the molecular formula C11H12ClNO and a molecular weight of 209.67 g/mol. IUPAC name: 1-(3-chlorophenyl)piperidin-2-one. InChIKey: QMCIOETXUFJTAK-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | 1-(3-chlorophenyl)piperidin-2-one |
| InChIKey | QMCIOETXUFJTAK-UHFFFAOYSA-N |
| SMILES | C1CCN(C(=O)C1)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)