CAS 132622-81-2 is the registry number for (2R,4R)-4-(Aminomethyl)-1-(tert-butoxycarbonyl)pyrrolidine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,4R)-4-(aminomethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 132622-81-2) is a chemical compound with the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. IUPAC name: (2R,4R)-4-(aminomethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: VWFCKAANOBELKO-HTQZYQBOSA-N.
| Molecular formula | C11H20N2O4 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | (2R,4R)-4-(aminomethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | VWFCKAANOBELKO-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H]1C(=O)O)CN |
Computed by PubChem (NCBI)