Products 132644-87-2
CAS 132644-87-2 appears in our catalog under these names: benzyl 2,2-dimethyl-4-oxo-piperidine-1-carboxylate, 97%, 97%, Benzyl 2,2-dimethyl-4-oxopiperidine-1-carboxylate 97%, Benzyl 2,2-dimethyl-4-oxopiperidine-1-carboxylate, 97%, benzyl 2,2-dimethyl-4-oxo-piperidine-1-carboxylate, 95%. Offered by: Chemat, Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 5g, 10g, 1g.
Benzyl 2,2-dimethyl-4-oxopiperidine-1-carboxylate (CAS 132644-87-2) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: benzyl 2,2-dimethyl-4-oxopiperidine-1-carboxylate. InChIKey: UKEQVZUQAYLCSG-UHFFFAOYSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | benzyl 2,2-dimethyl-4-oxopiperidine-1-carboxylate |
| InChIKey | UKEQVZUQAYLCSG-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)CCN1C(=O)OCC2=CC=CC=C2)C |
Computed by PubChem (NCBI)