CAS 132648-81-8 is the registry number for Carbamazepine Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,9-dichloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethanone (CAS 132648-81-8) is a chemical compound with the molecular formula C16H13Cl2NO and a molecular weight of 306.2 g/mol. IUPAC name: 1-(2,9-dichloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethanone. InChIKey: HMAVFYLOMIJBQR-UHFFFAOYSA-N.
| Molecular formula | C16H13Cl2NO |
|---|---|
| Molecular weight | 306.2 g/mol |
| IUPAC name | 1-(2,9-dichloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethanone |
| InChIKey | HMAVFYLOMIJBQR-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C2=C(CCC3=C1C=C(C=C3)Cl)C=CC(=C2)Cl |
Computed by PubChem (NCBI)