CAS 92407-92-6 is the registry number for (1-(2,4-Dichlorobenzyl)-1H-indol-3-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methanol (CAS 92407-92-6) is a chemical compound with the molecular formula C16H13Cl2NO and a molecular weight of 306.2 g/mol. IUPAC name: [1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methanol. InChIKey: XIEMZENDWGRWLP-UHFFFAOYSA-N.
| Molecular formula | C16H13Cl2NO |
|---|---|
| Molecular weight | 306.2 g/mol |
| IUPAC name | [1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methanol |
| InChIKey | XIEMZENDWGRWLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2CC3=C(C=C(C=C3)Cl)Cl)CO |
Computed by PubChem (NCBI)