CAS 152642-35-8 appears in our catalog under these names: Sertraline Impurity 20, Sertraline Impurity 2 (Sertraline Oxime), Sertraline Impurity 26, 4-(3’,4’-Dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one Oxime, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(NE)-N-[4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-ylidene]hydroxylamine (CAS 152642-35-8) is a chemical compound with the molecular formula C16H13Cl2NO and a molecular weight of 306.2 g/mol. IUPAC name: (NE)-N-[4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-ylidene]hydroxylamine. InChIKey: CGIUOCJZIYTDRG-KNTRCKAVSA-N.
| Molecular formula | C16H13Cl2NO |
|---|---|
| Molecular weight | 306.2 g/mol |
| IUPAC name | (NE)-N-[4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-ylidene]hydroxylamine |
| InChIKey | CGIUOCJZIYTDRG-KNTRCKAVSA-N |
| SMILES | C1C/C(=N\O)/C2=CC=CC=C2C1C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)