CAS 1326743-67-2 is the registry number for 3-((Dimethylamino)methyl)-1H-indole-4-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
3-[(dimethylamino)methyl]-1H-indole-4-carboxylic acid;hydrochloride (CAS 1326743-67-2) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: 3-[(dimethylamino)methyl]-1H-indole-4-carboxylic acid;hydrochloride. InChIKey: FVCNCQPLBDIPQR-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | 3-[(dimethylamino)methyl]-1H-indole-4-carboxylic acid;hydrochloride |
| InChIKey | FVCNCQPLBDIPQR-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CNC2=CC=CC(=C21)C(=O)O.Cl |
Computed by PubChem (NCBI)