CAS 132715-69-6 appears in our catalog under these names: 2-Bromo-3-fluorobenzoic acid, 2-Bromo-3-fluorobenzoic Acid, >96.0%(GC)(T), 2-Bromo-3-fluorobenzoic acid 98%, 2-Bromo-3-fluorobenzoic acid, 96%. Offered by: Biosynth, TCI, Ambeed, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 50g, 100g, 500g.
2-bromo-3-fluorobenzoic acid (CAS 132715-69-6) is a chemical compound with the molecular formula C7H4BrFO2 and a molecular weight of 219.01 g/mol. IUPAC name: 2-bromo-3-fluorobenzoic acid. InChIKey: KQRCBMPPEPNNDS-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO2 |
|---|---|
| Molecular weight | 219.01 g/mol |
| IUPAC name | 2-bromo-3-fluorobenzoic acid |
| InChIKey | KQRCBMPPEPNNDS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)Br)C(=O)O |
Computed by PubChem (NCBI)