Products 13278-35-8

CAS 13278-35-8 is the registry number for 2-((4-Chlorophenyl)amino)benzoic acid, 98%+,RG, 98%+,RG. Offered by: Chemat. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(4-chloroanilino)benzoic acid (CAS 13278-35-8) is a chemical compound with the molecular formula C13H10ClNO2 and a molecular weight of 247.67 g/mol. IUPAC name: 2-(4-chloroanilino)benzoic acid. InChIKey: YZTPXKMADXYVOJ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10ClNO2
Molecular weight247.67 g/mol
IUPAC name2-(4-chloroanilino)benzoic acid
InChIKeyYZTPXKMADXYVOJ-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)O)NC2=CC=C(C=C2)Cl

Computed by PubChem (NCBI)