Products 132813-22-0
CAS 132813-22-0 is the registry number for Blonanserin Impurity 26. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-4-(4-chlorophenyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine (CAS 132813-22-0) is a chemical compound with the molecular formula C17H17Cl2N and a molecular weight of 306.2 g/mol. IUPAC name: 2-chloro-4-(4-chlorophenyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine. InChIKey: NBFJSUJBQMGPTF-UHFFFAOYSA-N.
| Molecular formula | C17H17Cl2N |
|---|---|
| Molecular weight | 306.2 g/mol |
| IUPAC name | 2-chloro-4-(4-chlorophenyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine |
| InChIKey | NBFJSUJBQMGPTF-UHFFFAOYSA-N |
| SMILES | C1CCCC2=C(CC1)C(=CC(=N2)Cl)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)