Products 79836-45-6
CAS 79836-45-6 appears in our catalog under these names: rac-trans-Sertraline, >95% (HPLC), Sertraline impurity 2. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, Get quote.
(1R,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 79836-45-6) is a chemical compound with the molecular formula C17H17Cl2N and a molecular weight of 306.2 g/mol. IUPAC name: (1R,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: VGKDLMBJGBXTGI-YVEFUNNKSA-N.
| Molecular formula | C17H17Cl2N |
|---|---|
| Molecular weight | 306.2 g/mol |
| IUPAC name | (1R,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | VGKDLMBJGBXTGI-YVEFUNNKSA-N |
| SMILES | CN[C@@H]1CC[C@H](C2=CC=CC=C12)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)