Products 1353970-82-7
CAS 1353970-82-7 is the registry number for N,N-Bis(3-chlorobenzyl)cyclopropanamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
N,N-bis[(3-chlorophenyl)methyl]cyclopropanamine (CAS 1353970-82-7) is a chemical compound with the molecular formula C17H17Cl2N and a molecular weight of 306.2 g/mol. IUPAC name: N,N-bis[(3-chlorophenyl)methyl]cyclopropanamine. InChIKey: QIGYOKZNGHOWQY-UHFFFAOYSA-N.
| Molecular formula | C17H17Cl2N |
|---|---|
| Molecular weight | 306.2 g/mol |
| IUPAC name | N,N-bis[(3-chlorophenyl)methyl]cyclopropanamine |
| InChIKey | QIGYOKZNGHOWQY-UHFFFAOYSA-N |
| SMILES | C1CC1N(CC2=CC(=CC=C2)Cl)CC3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)