CAS 13291-61-7 appears in our catalog under these names: trans–1,2–Cyclohexanediaminetetraacetic acid, trans-1,2-Cyclohexanediaminetetraacetic acid 98%, Glycine, N,N'-(1R,2R)-1,2-cyclohexanediylbis[N-(carboxymethyl)-, rel-, 98%, 98%, trans-1,2-Cyclohexanediaminetetraacetic acid, 97.0%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 500mg, 1g, 5g, 25g, 100g, 10g, 15g, 50g.
2-[[(1R,2R)-2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid (CAS 13291-61-7) is a chemical compound with the molecular formula C14H22N2O8 and a molecular weight of 346.33 g/mol. IUPAC name: 2-[[(1R,2R)-2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid. InChIKey: FCKYPQBAHLOOJQ-NXEZZACHSA-N.
| Molecular formula | C14H22N2O8 |
|---|---|
| Molecular weight | 346.33 g/mol |
| IUPAC name | 2-[[(1R,2R)-2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid |
| InChIKey | FCKYPQBAHLOOJQ-NXEZZACHSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)N(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)