CAS 2138426-34-1 is the registry number for Oxalic acid, tert-butyl 5-(aminomethyl)-7-oxo-6-oxa-2-azaspiro(3.4)octane-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 5-(aminomethyl)-7-oxo-6-oxa-2-azaspiro[3.4]octane-2-carboxylate;oxalic acid (CAS 2138426-34-1) is a chemical compound with the molecular formula C14H22N2O8 and a molecular weight of 346.33 g/mol. IUPAC name: tert-butyl 5-(aminomethyl)-7-oxo-6-oxa-2-azaspiro[3.4]octane-2-carboxylate;oxalic acid. InChIKey: QSIOYRXJVQLPRY-UHFFFAOYSA-N.
| Molecular formula | C14H22N2O8 |
|---|---|
| Molecular weight | 346.33 g/mol |
| IUPAC name | tert-butyl 5-(aminomethyl)-7-oxo-6-oxa-2-azaspiro[3.4]octane-2-carboxylate;oxalic acid |
| InChIKey | QSIOYRXJVQLPRY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(=O)OC2CN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)