Products 2247087-97-2
CAS 2247087-97-2 is the registry number for (3R)-1,3-Dimethylpiperazine bis((2Z)-but-2-enedioate. Offered by: Biosynth. Available pack sizes: 1g, 10g.
Bis((Z)-but-2-enedioic acid);(3R)-1,3-dimethylpiperazine (CAS 2247087-97-2) is a chemical compound with the molecular formula C14H22N2O8 and a molecular weight of 346.33 g/mol. IUPAC name: bis((Z)-but-2-enedioic acid);(3R)-1,3-dimethylpiperazine. InChIKey: UZVCWWTUZOGJHH-FOHCUELHSA-N.
| Molecular formula | C14H22N2O8 |
|---|---|
| Molecular weight | 346.33 g/mol |
| IUPAC name | bis((Z)-but-2-enedioic acid);(3R)-1,3-dimethylpiperazine |
| InChIKey | UZVCWWTUZOGJHH-FOHCUELHSA-N |
| SMILES | C[C@H]1NCCN(C1)C.C(=C\C(=O)O)\C(=O)O.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)