CAS 132920-93-5 is the registry number for 2,3,4-Trifluoro-6-Nitrobenzoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 750mg.
2,3,4-trifluoro-6-nitrobenzoic acid (CAS 132920-93-5) is a chemical compound with the molecular formula C7H2F3NO4 and a molecular weight of 221.09 g/mol. IUPAC name: 2,3,4-trifluoro-6-nitrobenzoic acid. InChIKey: CHBJKZJLVDBUGA-UHFFFAOYSA-N.
| Molecular formula | C7H2F3NO4 |
|---|---|
| Molecular weight | 221.09 g/mol |
| IUPAC name | 2,3,4-trifluoro-6-nitrobenzoic acid |
| InChIKey | CHBJKZJLVDBUGA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)F)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)