CAS 1803842-19-4 is the registry number for 3-Nitro-2,4,6-trifluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,4,6-trifluoro-3-nitrobenzoic acid (CAS 1803842-19-4) is a chemical compound with the molecular formula C7H2F3NO4 and a molecular weight of 221.09 g/mol. IUPAC name: 2,4,6-trifluoro-3-nitrobenzoic acid. InChIKey: UGWVEBDJAYWCHI-UHFFFAOYSA-N.
| Molecular formula | C7H2F3NO4 |
|---|---|
| Molecular weight | 221.09 g/mol |
| IUPAC name | 2,4,6-trifluoro-3-nitrobenzoic acid |
| InChIKey | UGWVEBDJAYWCHI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)[N+](=O)[O-])F)C(=O)O)F |
Computed by PubChem (NCBI)