Products 1803842-19-4

CAS 1803842-19-4 is the registry number for 3-Nitro-2,4,6-trifluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2,4,6-trifluoro-3-nitrobenzoic acid (CAS 1803842-19-4) is a chemical compound with the molecular formula C7H2F3NO4 and a molecular weight of 221.09 g/mol. IUPAC name: 2,4,6-trifluoro-3-nitrobenzoic acid. InChIKey: UGWVEBDJAYWCHI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H2F3NO4
Molecular weight221.09 g/mol
IUPAC name2,4,6-trifluoro-3-nitrobenzoic acid
InChIKeyUGWVEBDJAYWCHI-UHFFFAOYSA-N
SMILESC1=C(C(=C(C(=C1F)[N+](=O)[O-])F)C(=O)O)F

Computed by PubChem (NCBI)