CAS 197520-71-1 appears in our catalog under these names: 5-Nitro-2,3,4-trifluorobenzoic acid, 97%, 5–Nitro–2,3,4–trifluorobenzoic Acid, 2,3,4-Trifluoro-5-Nitro-Benzoic Acid/ 96.2% (existing batch purity), 2,3,4-Trifluoro-5-Nitro-Benzoic Acid 97%, 2,3,4-Trifluoro-5-nitrobenzoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, TargetMol, Ambeed, Chemat. Available pack sizes: 5g, 25g, 100g, 1g, 500g, 5mg, 10mg, 25mg.
2,3,4-trifluoro-5-nitrobenzoic acid (CAS 197520-71-1) is a chemical compound with the molecular formula C7H2F3NO4 and a molecular weight of 221.09 g/mol. IUPAC name: 2,3,4-trifluoro-5-nitrobenzoic acid. InChIKey: BCMIOBTWFPSPJJ-UHFFFAOYSA-N.
| Molecular formula | C7H2F3NO4 |
|---|---|
| Molecular weight | 221.09 g/mol |
| IUPAC name | 2,3,4-trifluoro-5-nitrobenzoic acid |
| InChIKey | BCMIOBTWFPSPJJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1[N+](=O)[O-])F)F)F)C(=O)O |
Computed by PubChem (NCBI)