CAS 1329497-00-8 appears in our catalog under these names: Nor Lidocaine-d5 Hydrochloride, Nor Lidocaine-d5 Hydrochloride, >95% (HPLC), Nor Lidocaine-d5 (hydrochloride). Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg, 10 mg.
N-(2,6-dimethylphenyl)-2-(1,1,2,2,2-pentadeuterioethylamino)acetamide;hydrochloride (CAS 1329497-00-8) is a chemical compound with the molecular formula C12H19ClN2O and a molecular weight of 247.77 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-2-(1,1,2,2,2-pentadeuterioethylamino)acetamide;hydrochloride. InChIKey: KPXFVVHMUVBVGI-UHBAQTEVSA-N.
| Molecular formula | C12H19ClN2O |
|---|---|
| Molecular weight | 247.77 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-2-(1,1,2,2,2-pentadeuterioethylamino)acetamide;hydrochloride |
| InChIKey | KPXFVVHMUVBVGI-UHBAQTEVSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])NCC(=O)NC1=C(C=CC=C1C)C.Cl |
Computed by PubChem (NCBI)