Products 1329616-33-2
CAS 1329616-33-2 appears in our catalog under these names: 2-Bromo-3'-methoxyacetophenone-13CD3, 2-Bromo-3'-methoxyacetophenone-13C,d3. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, 25mg, 50 mg, 10 mg, 100 mg, 250 mg, 25 mg.
2-bromo-1-[3-(trideuterio(113C)methoxy)phenyl]ethanone (CAS 1329616-33-2) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 233.08 g/mol. IUPAC name: 2-bromo-1-[3-(trideuterio(113C)methoxy)phenyl]ethanone. InChIKey: IOOHBIFQNQQUFI-KQORAOOSSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 233.08 g/mol |
| IUPAC name | 2-bromo-1-[3-(trideuterio(113C)methoxy)phenyl]ethanone |
| InChIKey | IOOHBIFQNQQUFI-KQORAOOSSA-N |
| SMILES | [2H][13C]([2H])([2H])OC1=CC=CC(=C1)C(=O)CBr |
Computed by PubChem (NCBI)