CAS 1329647-21-3 is the registry number for Orphenadrine-d3 N-Oxide. Offered by: TRC. Available pack sizes: 100mg.
N-methyl-2-[(2-methylphenyl)-phenylmethoxy]-N-(trideuteriomethyl)ethanamine oxide (CAS 1329647-21-3) is a chemical compound with the molecular formula C18H23NO2 and a molecular weight of 288.4 g/mol. IUPAC name: N-methyl-2-[(2-methylphenyl)-phenylmethoxy]-N-(trideuteriomethyl)ethanamine oxide. InChIKey: XMSSICJSZNPVFX-BMSJAHLVSA-N.
| Molecular formula | C18H23NO2 |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | N-methyl-2-[(2-methylphenyl)-phenylmethoxy]-N-(trideuteriomethyl)ethanamine oxide |
| InChIKey | XMSSICJSZNPVFX-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])[N+](C)(CCOC(C1=CC=CC=C1)C2=CC=CC=C2C)[O-] |
Computed by PubChem (NCBI)