CAS 132973-43-4 appears in our catalog under these names: 4-Aminomethyl-2(1H)-quinolinone, 4-Aminomethyl-2(1h)-quinolinone, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg.
4-(aminomethyl)-1H-quinolin-2-one (CAS 132973-43-4) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 4-(aminomethyl)-1H-quinolin-2-one. InChIKey: RDXKAGOGKMCTBH-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 4-(aminomethyl)-1H-quinolin-2-one |
| InChIKey | RDXKAGOGKMCTBH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=O)N2)CN |
Computed by PubChem (NCBI)