Products 1329802-41-6
CAS 1329802-41-6 appears in our catalog under these names: Pyrrole-2,3-dicarboxylic Acid Monohydrate, >95% (HPLC), Pyrrole-2,3-Dicarboxylic Acid Monohydrate, ≥98%, ≥98%. Offered by: TRC, Chemat. Available pack sizes: 50mg, 5mg, 25mg, 100mg.
1H-pyrrole-2,3-dicarboxylic acid;hydrate (CAS 1329802-41-6) is a chemical compound with the molecular formula C6H7NO5 and a molecular weight of 173.12 g/mol. IUPAC name: 1H-pyrrole-2,3-dicarboxylic acid;hydrate. InChIKey: HBPXOPVAWXDKDD-UHFFFAOYSA-N.
| Molecular formula | C6H7NO5 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 1H-pyrrole-2,3-dicarboxylic acid;hydrate |
| InChIKey | HBPXOPVAWXDKDD-UHFFFAOYSA-N |
| SMILES | C1=CNC(=C1C(=O)O)C(=O)O.O |
Computed by PubChem (NCBI)