CAS 938459-18-8 appears in our catalog under these names: (3,5-Dioxomorpholin-4-yl)acetic acid, 95%, 2-(3,5-Dioxomorpholino)acetic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(3,5-dioxomorpholin-4-yl)acetic acid (CAS 938459-18-8) is a chemical compound with the molecular formula C6H7NO5 and a molecular weight of 173.12 g/mol. IUPAC name: 2-(3,5-dioxomorpholin-4-yl)acetic acid. InChIKey: PVKKQZFUVVGWEX-UHFFFAOYSA-N.
| Molecular formula | C6H7NO5 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 2-(3,5-dioxomorpholin-4-yl)acetic acid |
| InChIKey | PVKKQZFUVVGWEX-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)CO1)CC(=O)O |
Computed by PubChem (NCBI)