Products 33658-49-0

CAS 33658-49-0 is the registry number for 2-(2,6-Dioxomorpholino)acetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(2,6-dioxomorpholin-4-yl)acetic acid (CAS 33658-49-0) is a chemical compound with the molecular formula C6H7NO5 and a molecular weight of 173.12 g/mol. IUPAC name: 2-(2,6-dioxomorpholin-4-yl)acetic acid. InChIKey: FHSPYXCBYKGRQZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7NO5
Molecular weight173.12 g/mol
IUPAC name2-(2,6-dioxomorpholin-4-yl)acetic acid
InChIKeyFHSPYXCBYKGRQZ-UHFFFAOYSA-N
SMILESC1C(=O)OC(=O)CN1CC(=O)O

Computed by PubChem (NCBI)