CAS 1329805-62-0 is the registry number for (-)-Normacromerine-d3. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 25mg, 100mg.
(1R)-1-(3,4-dimethoxyphenyl)-2-(trideuteriomethylamino)ethanol (CAS 1329805-62-0) is a chemical compound with the molecular formula C11H17NO3 and a molecular weight of 214.28 g/mol. IUPAC name: (1R)-1-(3,4-dimethoxyphenyl)-2-(trideuteriomethylamino)ethanol. InChIKey: QSUCQAULQIAOEP-XYFUXNRQSA-N.
| Molecular formula | C11H17NO3 |
|---|---|
| Molecular weight | 214.28 g/mol |
| IUPAC name | (1R)-1-(3,4-dimethoxyphenyl)-2-(trideuteriomethylamino)ethanol |
| InChIKey | QSUCQAULQIAOEP-XYFUXNRQSA-N |
| SMILES | [2H]C([2H])([2H])NC[C@@H](C1=CC(=C(C=C1)OC)OC)O |
Computed by PubChem (NCBI)