CAS 1329837-80-0 is the registry number for 4-(4-Aminophenyl)-3-morpholinone-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 100 mg, 10 mg.
4-(4-amino-2,3,5,6-tetradeuteriophenyl)morpholin-3-one (CAS 1329837-80-0) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 196.24 g/mol. IUPAC name: 4-(4-amino-2,3,5,6-tetradeuteriophenyl)morpholin-3-one. InChIKey: MHCRLDZZHOVFEE-RHQRLBAQSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 4-(4-amino-2,3,5,6-tetradeuteriophenyl)morpholin-3-one |
| InChIKey | MHCRLDZZHOVFEE-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])N2CCOCC2=O)[2H] |
Computed by PubChem (NCBI)