Products 1329837-80-0

CAS 1329837-80-0 is the registry number for 4-(4-Aminophenyl)-3-morpholinone-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 100 mg, 10 mg.

Structural formula: {0} (CAS {1})

4-(4-amino-2,3,5,6-tetradeuteriophenyl)morpholin-3-one (CAS 1329837-80-0) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 196.24 g/mol. IUPAC name: 4-(4-amino-2,3,5,6-tetradeuteriophenyl)morpholin-3-one. InChIKey: MHCRLDZZHOVFEE-RHQRLBAQSA-N.

Identity
Molecular formulaC10H12N2O2
Molecular weight196.24 g/mol
IUPAC name4-(4-amino-2,3,5,6-tetradeuteriophenyl)morpholin-3-one
InChIKeyMHCRLDZZHOVFEE-RHQRLBAQSA-N
SMILES[2H]C1=C(C(=C(C(=C1N)[2H])[2H])N2CCOCC2=O)[2H]

Computed by PubChem (NCBI)