Products 132993-79-4
CAS 132993-79-4 is the registry number for DL78. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg.
(5-methoxy-1-benzofuran-2-yl)-(5-methoxy-2-methyl-1-benzofuran-3-yl)methanone (CAS 132993-79-4) is a chemical compound with the molecular formula C20H16O5 and a molecular weight of 336.3 g/mol. IUPAC name: (5-methoxy-1-benzofuran-2-yl)-(5-methoxy-2-methyl-1-benzofuran-3-yl)methanone. InChIKey: KUYVBSWFAOHPPI-UHFFFAOYSA-N.
| Molecular formula | C20H16O5 |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | (5-methoxy-1-benzofuran-2-yl)-(5-methoxy-2-methyl-1-benzofuran-3-yl)methanone |
| InChIKey | KUYVBSWFAOHPPI-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(O1)C=CC(=C2)OC)C(=O)C3=CC4=C(O3)C=CC(=C4)OC |
Computed by PubChem (NCBI)