CAS 1330180-06-7 is the registry number for tert-Butyl N-(1-carbamimidoylethyl)carbamate hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Tert-butyl N-(1-amino-1-iminopropan-2-yl)carbamate;hydrochloride (CAS 1330180-06-7) is a chemical compound with the molecular formula C8H18ClN3O2 and a molecular weight of 223.70 g/mol. IUPAC name: tert-butyl N-(1-amino-1-iminopropan-2-yl)carbamate;hydrochloride. InChIKey: LYBYSYDYQLVOFF-UHFFFAOYSA-N.
| Molecular formula | C8H18ClN3O2 |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | tert-butyl N-(1-amino-1-iminopropan-2-yl)carbamate;hydrochloride |
| InChIKey | LYBYSYDYQLVOFF-UHFFFAOYSA-N |
| SMILES | CC(C(=N)N)NC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)