Products 1330180-06-7

CAS 1330180-06-7 is the registry number for tert-Butyl N-(1-carbamimidoylethyl)carbamate hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(1-amino-1-iminopropan-2-yl)carbamate;hydrochloride (CAS 1330180-06-7) is a chemical compound with the molecular formula C8H18ClN3O2 and a molecular weight of 223.70 g/mol. IUPAC name: tert-butyl N-(1-amino-1-iminopropan-2-yl)carbamate;hydrochloride. InChIKey: LYBYSYDYQLVOFF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H18ClN3O2
Molecular weight223.70 g/mol
IUPAC nametert-butyl N-(1-amino-1-iminopropan-2-yl)carbamate;hydrochloride
InChIKeyLYBYSYDYQLVOFF-UHFFFAOYSA-N
SMILESCC(C(=N)N)NC(=O)OC(C)(C)C.Cl

Computed by PubChem (NCBI)