Products 151266-67-0
CAS 151266-67-0 is the registry number for H-Ala-Val-NH2·HCl. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg.
(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanamide;hydrochloride (CAS 151266-67-0) is a chemical compound with the molecular formula C8H18ClN3O2 and a molecular weight of 223.70 g/mol. IUPAC name: (2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanamide;hydrochloride. InChIKey: KJOCCEZZYIMGRI-GEMLJDPKSA-N.
| Molecular formula | C8H18ClN3O2 |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanamide;hydrochloride |
| InChIKey | KJOCCEZZYIMGRI-GEMLJDPKSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C(C)C)C(=O)N)N.Cl |
Computed by PubChem (NCBI)